C23H26O2S — CID 14776663
4-[(E)-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoic acid (PubChem CID 14776663) has the molecular formula C23H26O2S and a molecular weight of 366.53 g/mol. Its IUPAC name is 4-[(E)-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoic acid.
| Compound Name | 4-[(E)-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 14776663 |
| Molecular Formula | C23H26O2S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 4-[(E)-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoic acid |
| SMILES | C/C(=C\c1ccc(C(=O)O)cc1)c1ccc2c(c1)C(C)(C)CC(C)(C)S2 |
| InChI | InChI=1S/C23H26O2S/c1-15(12-16-6-8-17(9-7-16)21(24)25)18-10-11-20-19(13-18)22(2,3)14-23(4,5)26-20/h6-13H,14H2,1-5H3,(H,24,25)/b15-12+ |
| InChIKey | BSFZDTINSFODDJ-NTCAYCPXSA-N |
| XLogP | 6.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|