C23H23F3O2S — CID 14776667
4-[(Z)-3,3,3-trifluoro-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoic acid (PubChem CID 14776667) has the molecular formula C23H23F3O2S and a molecular weight of 420.50 g/mol. Its IUPAC name is 4-[(Z)-3,3,3-trifluoro-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoic acid.
| Compound Name | 4-[(Z)-3,3,3-trifluoro-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 14776667 |
| Molecular Formula | C23H23F3O2S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 4-[(Z)-3,3,3-trifluoro-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoic acid |
| SMILES | CC1(C)CC(C)(C)c2cc(/C(=C/c3ccc(C(=O)O)cc3)C(F)(F)F)ccc2S1 |
| InChI | InChI=1S/C23H23F3O2S/c1-21(2)13-22(3,4)29-19-10-9-16(12-18(19)21)17(23(24,25)26)11-14-5-7-15(8-6-14)20(27)28/h5-12H,13H2,1-4H3,(H,27,28)/b17-11- |
| InChIKey | SYIQGBTULWYEQG-BOPFTXTBSA-N |
| XLogP | 7.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|