C21H19F3O2S — CID 14776672
4-[(Z)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-3,3,3-trifluoroprop-1-enyl]benzoic acid (PubChem CID 14776672) has the molecular formula C21H19F3O2S and a molecular weight of 392.44 g/mol. Its IUPAC name is 4-[(Z)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-3,3,3-trifluoroprop-1-enyl]benzoic acid.
| Compound Name | 4-[(Z)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-3,3,3-trifluoroprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 14776672 |
| Molecular Formula | C21H19F3O2S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 4-[(Z)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-3,3,3-trifluoroprop-1-enyl]benzoic acid |
| SMILES | CC1(C)CCSc2ccc(/C(=C/c3ccc(C(=O)O)cc3)C(F)(F)F)cc21 |
| InChI | InChI=1S/C21H19F3O2S/c1-20(2)9-10-27-18-8-7-15(12-17(18)20)16(21(22,23)24)11-13-3-5-14(6-4-13)19(25)26/h3-8,11-12H,9-10H2,1-2H3,(H,25,26)/b16-11- |
| InChIKey | KDNYHJVBYNMARH-WJDWOHSUSA-N |
| XLogP | 6.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|