About 4-[(E)-2-(3,3-dimethyl-2H-1-benzothiophen-5-yl)prop-1-enyl]benzoic acid
4-[(E)-2-(3,3-dimethyl-2H-1-benzothiophen-5-yl)prop-1-enyl]benzoic acid (PubChem CID 14776682) has the molecular formula C20H20O2S
and a molecular weight of 324.45 g/mol. Its IUPAC name is 4-[(E)-2-(3,3-dimethyl-2H-1-benzothiophen-5-yl)prop-1-enyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[(E)-2-(3,3-dimethyl-2H-1-benzothiophen-5-yl)prop-1-enyl]benzoic acid |
| PubChem CID | 14776682 |
| Molecular Formula | C20H20O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 4-[(E)-2-(3,3-dimethyl-2H-1-benzothiophen-5-yl)prop-1-enyl]benzoic acid |
| SMILES | C/C(=C\c1ccc(C(=O)O)cc1)c1ccc2c(c1)C(C)(C)CS2 |
| InChI | InChI=1S/C20H20O2S/c1-13(10-14-4-6-15(7-5-14)19(21)22)16-8-9-18-17(11-16)20(2,3)12-23-18/h4-11H,12H2,1-3H3,(H,21,22)/b13-10+ |
| InChIKey | JPFUTCKBWPEHMJ-JLHYYAGUSA-N |
| XLogP | 5.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-(3,3-dimethyl-2H-1-benzothiophen-5-yl)prop-1-enyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-(3,3-dimethyl-2H-1-benzothiophen-5-yl)prop-1-enyl]benzoic acid?
The IUPAC name of 4-[(E)-2-(3,3-dimethyl-2H-1-benzothiophen-5-yl)prop-1-enyl]benzoic acid (CID 14776682) is 4-[(E)-2-(3,3-dimethyl-2H-1-benzothiophen-5-yl)prop-1-enyl]benzoic acid.
What is the SMILES notation for 4-[(E)-2-(3,3-dimethyl-2H-1-benzothiophen-5-yl)prop-1-enyl]benzoic acid?
The canonical SMILES for 4-[(E)-2-(3,3-dimethyl-2H-1-benzothiophen-5-yl)prop-1-enyl]benzoic acid is C/C(=C\c1ccc(C(=O)O)cc1)c1ccc2c(c1)C(C)(C)CS2.
What is the InChIKey of 4-[(E)-2-(3,3-dimethyl-2H-1-benzothiophen-5-yl)prop-1-enyl]benzoic acid?
The InChIKey is JPFUTCKBWPEHMJ-JLHYYAGUSA-N. The full InChI is InChI=1S/C20H20O2S/c1-13(10-14-4-6-15(7-5-14)19(21)22)16-8-9-18-17(11-16)20(2,3)12-23-18/h4-11H,12H2,1-3H3,(H,21,22)/b13-10+.
What are the key properties of 4-[(E)-2-(3,3-dimethyl-2H-1-benzothiophen-5-yl)prop-1-enyl]benzoic acid?
4-[(E)-2-(3,3-dimethyl-2H-1-benzothiophen-5-yl)prop-1-enyl]benzoic acid has a molecular weight of 324.45 g/mol, XLogP of 5.33, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-(3,3-dimethyl-2H-1-benzothiophen-5-yl)prop-1-enyl]benzoic acid is sourced from PubChem (CID 14776682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).