C6H14N2 — CID 147768838
1-(1-methylcyclopropyl)ethane-1,2-diamine (PubChem CID 147768838) has the molecular formula C6H14N2 and a molecular weight of 114.19 g/mol. Its IUPAC name is 1-(1-methylcyclopropyl)ethane-1,2-diamine.
| Compound Name | 1-(1-methylcyclopropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 147768838 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | 1-(1-methylcyclopropyl)ethane-1,2-diamine |
| SMILES | CC1(C(N)CN)CC1 |
| InChI | InChI=1S/C6H14N2/c1-6(2-3-6)5(8)4-7/h5H,2-4,7-8H2,1H3 |
| InChIKey | PHERCRTULMUMOJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |