C14H19NOS — CID 14776997
(2E,4E)-N-(2-methylpropyl)-6-thiophen-2-ylhexa-2,4-dienamide (PubChem CID 14776997) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is (2E,4E)-N-(2-methylpropyl)-6-thiophen-2-ylhexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-methylpropyl)-6-thiophen-2-ylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 14776997 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (2E,4E)-N-(2-methylpropyl)-6-thiophen-2-ylhexa-2,4-dienamide |
| SMILES | CC(C)CNC(=O)/C=C/C=C/Cc1cccs1 |
| InChI | InChI=1S/C14H19NOS/c1-12(2)11-15-14(16)9-5-3-4-7-13-8-6-10-17-13/h3-6,8-10,12H,7,11H2,1-2H3,(H,15,16)/b4-3+,9-5+ |
| InChIKey | KNGBXFMEGLRFHV-PRKJJMSOSA-N |
| XLogP | 3.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|