C18H14O14S2 — CID 14777415
(7,14-diethoxy-3,10-dioxo-13-sulfooxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-6-yl) hydrogen sulfate (PubChem CID 14777415) has the molecular formula C18H14O14S2 and a molecular weight of 518.43 g/mol. Its IUPAC name is (7,14-diethoxy-3,10-dioxo-13-sulfooxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-6-yl) hydrogen sulfate.
| Compound Name | (7,14-diethoxy-3,10-dioxo-13-sulfooxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-6-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 14777415 |
| Molecular Formula | C18H14O14S2 |
| Molecular Weight | 518.43 g/mol |
| Exact Mass | 517.98 |
| IUPAC Name | (7,14-diethoxy-3,10-dioxo-13-sulfooxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-6-yl) hydrogen sulfate |
| SMILES | CCOc1c(OS(=O)(=O)O)cc2c(=O)oc3c(OCC)c(OS(=O)(=O)O)cc4c(=O)oc1c2c34 |
| InChI | InChI=1S/C18H14O14S2/c1-3-27-13-9(31-33(21,22)23)5-7-11-12-8(17(19)29-15(11)13)6-10(32-34(24,25)26)14(28-4-2)16(12)30-18(7)20/h5-6H,3-4H2,1-2H3,(H,21,22,23)(H,24,25,26) |
| InChIKey | HJIRVDSFKFGFIJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 206.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|