C21H23F3N2O3 — CID 147774576
7-hydroxy-7-methyl-1-[1-[4-(trifluoromethoxy)phenyl]piperidin-4-yl]-4,6-dihydro-3H-isoindol-5-one (PubChem CID 147774576) has the molecular formula C21H23F3N2O3 and a molecular weight of 408.42 g/mol. Its IUPAC name is 7-hydroxy-7-methyl-1-[1-[4-(trifluoromethoxy)phenyl]piperidin-4-yl]-4,6-dihydro-3H-isoindol-5-one.
| Compound Name | 7-hydroxy-7-methyl-1-[1-[4-(trifluoromethoxy)phenyl]piperidin-4-yl]-4,6-dihydro-3H-isoindol-5-one |
|---|---|
| PubChem CID | 147774576 |
| Molecular Formula | C21H23F3N2O3 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 7-hydroxy-7-methyl-1-[1-[4-(trifluoromethoxy)phenyl]piperidin-4-yl]-4,6-dihydro-3H-isoindol-5-one |
| SMILES | CC1(O)CC(=O)CC2=C1C(C1CCN(c3ccc(OC(F)(F)F)cc3)CC1)=NC2 |
| InChI | InChI=1S/C21H23F3N2O3/c1-20(28)11-16(27)10-14-12-25-19(18(14)20)13-6-8-26(9-7-13)15-2-4-17(5-3-15)29-21(22,23)24/h2-5,13,28H,6-12H2,1H3 |
| InChIKey | HGOUSAUUGHVXON-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|