About 8-methyl-3-methylidene-2,4-dihydro-1H-naphthalene
8-methyl-3-methylidene-2,4-dihydro-1H-naphthalene (PubChem CID 147775008) has the molecular formula C12H14
and a molecular weight of 158.24 g/mol. Its IUPAC name is 8-methyl-3-methylidene-2,4-dihydro-1H-naphthalene.
Molecular Properties
| Compound Name | 8-methyl-3-methylidene-2,4-dihydro-1H-naphthalene |
| PubChem CID | 147775008 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 8-methyl-3-methylidene-2,4-dihydro-1H-naphthalene |
| SMILES | C=C1CCc2c(C)cccc2C1 |
| InChI | InChI=1S/C12H14/c1-9-6-7-12-10(2)4-3-5-11(12)8-9/h3-5H,1,6-8H2,2H3 |
| InChIKey | HGQYOPLUJZPJSO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-3-methylidene-2,4-dihydro-1H-naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-3-methylidene-2,4-dihydro-1H-naphthalene?
The IUPAC name of 8-methyl-3-methylidene-2,4-dihydro-1H-naphthalene (CID 147775008) is 8-methyl-3-methylidene-2,4-dihydro-1H-naphthalene.
What is the SMILES notation for 8-methyl-3-methylidene-2,4-dihydro-1H-naphthalene?
The canonical SMILES for 8-methyl-3-methylidene-2,4-dihydro-1H-naphthalene is C=C1CCc2c(C)cccc2C1.
What is the InChIKey of 8-methyl-3-methylidene-2,4-dihydro-1H-naphthalene?
The InChIKey is HGQYOPLUJZPJSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14/c1-9-6-7-12-10(2)4-3-5-11(12)8-9/h3-5H,1,6-8H2,2H3.
What are the key properties of 8-methyl-3-methylidene-2,4-dihydro-1H-naphthalene?
8-methyl-3-methylidene-2,4-dihydro-1H-naphthalene has a molecular weight of 158.24 g/mol, XLogP of 3.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-3-methylidene-2,4-dihydro-1H-naphthalene is sourced from PubChem (CID 147775008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).