C18H22F2N2O — CID 14777527
(2S,3R,5S)-2,5-diamino-4,4-difluoro-1,6-diphenylhexan-3-ol (PubChem CID 14777527) has the molecular formula C18H22F2N2O and a molecular weight of 320.38 g/mol. Its IUPAC name is (2S,3R,5S)-2,5-diamino-4,4-difluoro-1,6-diphenylhexan-3-ol.
| Compound Name | (2S,3R,5S)-2,5-diamino-4,4-difluoro-1,6-diphenylhexan-3-ol |
|---|---|
| PubChem CID | 14777527 |
| Molecular Formula | C18H22F2N2O |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (2S,3R,5S)-2,5-diamino-4,4-difluoro-1,6-diphenylhexan-3-ol |
| SMILES | N[C@@H](Cc1ccccc1)[C@@H](O)C(F)(F)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C18H22F2N2O/c19-18(20,16(22)12-14-9-5-2-6-10-14)17(23)15(21)11-13-7-3-1-4-8-13/h1-10,15-17,23H,11-12,21-22H2/t15-,16-,17+/m0/s1 |
| InChIKey | OCRVZCTVLJXCAO-YESZJQIVSA-N |
| XLogP | 2.12 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |