About methyl 4-(1,3-oxazol-5-yl)benzoate
methyl 4-(1,3-oxazol-5-yl)benzoate (PubChem CID 1477779) has the molecular formula C11H9NO3
and a molecular weight of 203.20 g/mol. Its IUPAC name is methyl 4-(1,3-oxazol-5-yl)benzoate.
Molecular Properties
| Compound Name | methyl 4-(1,3-oxazol-5-yl)benzoate |
| PubChem CID | 1477779 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | methyl 4-(1,3-oxazol-5-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C11H9NO3/c1-14-11(13)9-4-2-8(3-5-9)10-6-12-7-15-10/h2-7H,1H3 |
| InChIKey | LFNHUUMUCVZCGY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-(1,3-oxazol-5-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(1,3-oxazol-5-yl)benzoate?
The IUPAC name of methyl 4-(1,3-oxazol-5-yl)benzoate (CID 1477779) is methyl 4-(1,3-oxazol-5-yl)benzoate.
What is the SMILES notation for methyl 4-(1,3-oxazol-5-yl)benzoate?
The canonical SMILES for methyl 4-(1,3-oxazol-5-yl)benzoate is COC(=O)c1ccc(-c2cnco2)cc1.
What is the InChIKey of methyl 4-(1,3-oxazol-5-yl)benzoate?
The InChIKey is LFNHUUMUCVZCGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3/c1-14-11(13)9-4-2-8(3-5-9)10-6-12-7-15-10/h2-7H,1H3.
What are the key properties of methyl 4-(1,3-oxazol-5-yl)benzoate?
methyl 4-(1,3-oxazol-5-yl)benzoate has a molecular weight of 203.20 g/mol, XLogP of 2.13, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1,3-oxazol-5-yl)benzoate is sourced from PubChem (CID 1477779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).