About 3-(5-hex-5-en-1,3-diynylthiophen-2-yl)prop-2-yn-1-ol
3-(5-hex-5-en-1,3-diynylthiophen-2-yl)prop-2-yn-1-ol (PubChem CID 14777887) has the molecular formula C13H8OS
and a molecular weight of 212.27 g/mol. Its IUPAC name is 3-(5-hex-5-en-1,3-diynylthiophen-2-yl)prop-2-yn-1-ol.
Molecular Properties
| Compound Name | 3-(5-hex-5-en-1,3-diynylthiophen-2-yl)prop-2-yn-1-ol |
| PubChem CID | 14777887 |
| Molecular Formula | C13H8OS |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 3-(5-hex-5-en-1,3-diynylthiophen-2-yl)prop-2-yn-1-ol |
| SMILES | C=CC#CC#Cc1ccc(C#CCO)s1 |
| InChI | InChI=1S/C13H8OS/c1-2-3-4-5-7-12-9-10-13(15-12)8-6-11-14/h2,9-10,14H,1,11H2 |
| InChIKey | DUEALUXZPCRPQC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-hex-5-en-1,3-diynylthiophen-2-yl)prop-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-hex-5-en-1,3-diynylthiophen-2-yl)prop-2-yn-1-ol?
The IUPAC name of 3-(5-hex-5-en-1,3-diynylthiophen-2-yl)prop-2-yn-1-ol (CID 14777887) is 3-(5-hex-5-en-1,3-diynylthiophen-2-yl)prop-2-yn-1-ol.
What is the SMILES notation for 3-(5-hex-5-en-1,3-diynylthiophen-2-yl)prop-2-yn-1-ol?
The canonical SMILES for 3-(5-hex-5-en-1,3-diynylthiophen-2-yl)prop-2-yn-1-ol is C=CC#CC#Cc1ccc(C#CCO)s1.
What is the InChIKey of 3-(5-hex-5-en-1,3-diynylthiophen-2-yl)prop-2-yn-1-ol?
The InChIKey is DUEALUXZPCRPQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8OS/c1-2-3-4-5-7-12-9-10-13(15-12)8-6-11-14/h2,9-10,14H,1,11H2.
What are the key properties of 3-(5-hex-5-en-1,3-diynylthiophen-2-yl)prop-2-yn-1-ol?
3-(5-hex-5-en-1,3-diynylthiophen-2-yl)prop-2-yn-1-ol has a molecular weight of 212.27 g/mol, XLogP of 1.63, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-hex-5-en-1,3-diynylthiophen-2-yl)prop-2-yn-1-ol is sourced from PubChem (CID 14777887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).