C11H18O4 — CID 147779184
ethyl 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxine-6-carboxylate (PubChem CID 147779184) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is ethyl 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxine-6-carboxylate.
| Compound Name | ethyl 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxine-6-carboxylate |
|---|---|
| PubChem CID | 147779184 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | ethyl 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxine-6-carboxylate |
| SMILES | CCOC(=O)C1CCC2OCCOC2C1 |
| InChI | InChI=1S/C11H18O4/c1-2-13-11(12)8-3-4-9-10(7-8)15-6-5-14-9/h8-10H,2-7H2,1H3 |
| InChIKey | MXUYJWHTODTEJT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |