C35H21N3OS — CID 147780895
2-[9-(4,6-diphenylpyrimidin-2-yl)dibenzofuran-4-yl]-1,3-benzothiazole (PubChem CID 147780895) has the molecular formula C35H21N3OS and a molecular weight of 531.64 g/mol. Its IUPAC name is 2-[9-(4,6-diphenylpyrimidin-2-yl)dibenzofuran-4-yl]-1,3-benzothiazole.
| Compound Name | 2-[9-(4,6-diphenylpyrimidin-2-yl)dibenzofuran-4-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 147780895 |
| Molecular Formula | C35H21N3OS |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | 2-[9-(4,6-diphenylpyrimidin-2-yl)dibenzofuran-4-yl]-1,3-benzothiazole |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3cccc4oc5c(-c6nc7ccccc7s6)cccc5c34)n2)cc1 |
| InChI | InChI=1S/C35H21N3OS/c1-3-11-22(12-4-1)28-21-29(23-13-5-2-6-14-23)37-34(36-28)25-16-10-19-30-32(25)24-15-9-17-26(33(24)39-30)35-38-27-18-7-8-20-31(27)40-35/h1-21H |
| InChIKey | HHTQTYFOBPLPME-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |