About [3,4,5-triacetyloxy-6-[(E)-3-ethenoxyprop-1-enoxy]oxan-2-yl]methyl acetate
[3,4,5-triacetyloxy-6-[(E)-3-ethenoxyprop-1-enoxy]oxan-2-yl]methyl acetate (PubChem CID 14778180) has the molecular formula C19H26O11
and a molecular weight of 430.41 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[(E)-3-ethenoxyprop-1-enoxy]oxan-2-yl]methyl acetate.
Molecular Properties
| Compound Name | [3,4,5-triacetyloxy-6-[(E)-3-ethenoxyprop-1-enoxy]oxan-2-yl]methyl acetate |
| PubChem CID | 14778180 |
| Molecular Formula | C19H26O11 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[(E)-3-ethenoxyprop-1-enoxy]oxan-2-yl]methyl acetate |
| SMILES | C=COC/C=C/OC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C19H26O11/c1-6-24-8-7-9-25-19-18(29-14(5)23)17(28-13(4)22)16(27-12(3)21)15(30-19)10-26-11(2)20/h6-7,9,15-19H,1,8,10H2,2-5H3/b9-7+ |
| InChIKey | KITDHIRSGQZGDF-VQHVLOKHSA-N |
| XLogP | 0.76 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3,4,5-triacetyloxy-6-[(E)-3-ethenoxyprop-1-enoxy]oxan-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,4,5-triacetyloxy-6-[(E)-3-ethenoxyprop-1-enoxy]oxan-2-yl]methyl acetate?
The IUPAC name of [3,4,5-triacetyloxy-6-[(E)-3-ethenoxyprop-1-enoxy]oxan-2-yl]methyl acetate (CID 14778180) is [3,4,5-triacetyloxy-6-[(E)-3-ethenoxyprop-1-enoxy]oxan-2-yl]methyl acetate.
What is the SMILES notation for [3,4,5-triacetyloxy-6-[(E)-3-ethenoxyprop-1-enoxy]oxan-2-yl]methyl acetate?
The canonical SMILES for [3,4,5-triacetyloxy-6-[(E)-3-ethenoxyprop-1-enoxy]oxan-2-yl]methyl acetate is C=COC/C=C/OC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O.
What is the InChIKey of [3,4,5-triacetyloxy-6-[(E)-3-ethenoxyprop-1-enoxy]oxan-2-yl]methyl acetate?
The InChIKey is KITDHIRSGQZGDF-VQHVLOKHSA-N. The full InChI is InChI=1S/C19H26O11/c1-6-24-8-7-9-25-19-18(29-14(5)23)17(28-13(4)22)16(27-12(3)21)15(30-19)10-26-11(2)20/h6-7,9,15-19H,1,8,10H2,2-5H3/b9-7+.
What are the key properties of [3,4,5-triacetyloxy-6-[(E)-3-ethenoxyprop-1-enoxy]oxan-2-yl]methyl acetate?
[3,4,5-triacetyloxy-6-[(E)-3-ethenoxyprop-1-enoxy]oxan-2-yl]methyl acetate has a molecular weight of 430.41 g/mol, XLogP of 0.76, 10 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for [3,4,5-triacetyloxy-6-[(E)-3-ethenoxyprop-1-enoxy]oxan-2-yl]methyl acetate is sourced from PubChem (CID 14778180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).