C28H24FN5O — CID 147781955
(5aR,6R,9aS)-3-(2-fluorophenyl)-6,9a-dimethyl-1-(1-methylbenzimidazol-2-yl)-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile (PubChem CID 147781955) has the molecular formula C28H24FN5O and a molecular weight of 465.53 g/mol. Its IUPAC name is (5aR,6R,9aS)-3-(2-fluorophenyl)-6,9a-dimethyl-1-(1-methylbenzimidazol-2-yl)-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-3-(2-fluorophenyl)-6,9a-dimethyl-1-(1-methylbenzimidazol-2-yl)-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 147781955 |
| Molecular Formula | C28H24FN5O |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | (5aR,6R,9aS)-3-(2-fluorophenyl)-6,9a-dimethyl-1-(1-methylbenzimidazol-2-yl)-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3c(c(-c4ccccc4F)nn3-c3nc4ccccc4n3C)CC[C@H]12 |
| InChI | InChI=1S/C28H24FN5O/c1-16-20-13-12-19-24(18-8-4-5-9-21(18)29)32-34(26(19)28(20,2)14-17(15-30)25(16)35)27-31-22-10-6-7-11-23(22)33(27)3/h4-11,14,16,20H,12-13H2,1-3H3/t16-,20-,28-/m1/s1 |
| InChIKey | HHYOUTULJXURPX-FYOXXRTDSA-N |
| XLogP | 5.05 |
| TPSA | 76.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |