About 8,8-dimethyl-6,10-dioxaspiro[4.5]dec-3-en-2-one
8,8-dimethyl-6,10-dioxaspiro[4.5]dec-3-en-2-one (PubChem CID 14778541) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is 8,8-dimethyl-6,10-dioxaspiro[4.5]dec-3-en-2-one.
Molecular Properties
| Compound Name | 8,8-dimethyl-6,10-dioxaspiro[4.5]dec-3-en-2-one |
| PubChem CID | 14778541 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 8,8-dimethyl-6,10-dioxaspiro[4.5]dec-3-en-2-one |
| SMILES | CC1(C)COC2(C=CC(=O)C2)OC1 |
| InChI | InChI=1S/C10H14O3/c1-9(2)6-12-10(13-7-9)4-3-8(11)5-10/h3-4H,5-7H2,1-2H3 |
| InChIKey | FABPEFGIVXAXDK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8,8-dimethyl-6,10-dioxaspiro[4.5]dec-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-dimethyl-6,10-dioxaspiro[4.5]dec-3-en-2-one?
The IUPAC name of 8,8-dimethyl-6,10-dioxaspiro[4.5]dec-3-en-2-one (CID 14778541) is 8,8-dimethyl-6,10-dioxaspiro[4.5]dec-3-en-2-one.
What is the SMILES notation for 8,8-dimethyl-6,10-dioxaspiro[4.5]dec-3-en-2-one?
The canonical SMILES for 8,8-dimethyl-6,10-dioxaspiro[4.5]dec-3-en-2-one is CC1(C)COC2(C=CC(=O)C2)OC1.
What is the InChIKey of 8,8-dimethyl-6,10-dioxaspiro[4.5]dec-3-en-2-one?
The InChIKey is FABPEFGIVXAXDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c1-9(2)6-12-10(13-7-9)4-3-8(11)5-10/h3-4H,5-7H2,1-2H3.
What are the key properties of 8,8-dimethyl-6,10-dioxaspiro[4.5]dec-3-en-2-one?
8,8-dimethyl-6,10-dioxaspiro[4.5]dec-3-en-2-one has a molecular weight of 182.22 g/mol, XLogP of 1.28, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-dimethyl-6,10-dioxaspiro[4.5]dec-3-en-2-one is sourced from PubChem (CID 14778541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).