About [(E)-[1-amino-2-(1,3-dioxepan-2-yl)ethylidene]amino] 4-(trifluoromethyl)pyridine-3-carboxylate
[(E)-[1-amino-2-(1,3-dioxepan-2-yl)ethylidene]amino] 4-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 147786276) has the molecular formula C14H16F3N3O4
and a molecular weight of 347.29 g/mol. Its IUPAC name is [(E)-[1-amino-2-(1,3-dioxepan-2-yl)ethylidene]amino] 4-(trifluoromethyl)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | [(E)-[1-amino-2-(1,3-dioxepan-2-yl)ethylidene]amino] 4-(trifluoromethyl)pyridine-3-carboxylate |
| PubChem CID | 147786276 |
| Molecular Formula | C14H16F3N3O4 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | [(E)-[1-amino-2-(1,3-dioxepan-2-yl)ethylidene]amino] 4-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | N/C(CC1OCCCCO1)=N/OC(=O)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C14H16F3N3O4/c15-14(16,17)10-3-4-19-8-9(10)13(21)24-20-11(18)7-12-22-5-1-2-6-23-12/h3-4,8,12H,1-2,5-7H2,(H2,18,20) |
| InChIKey | HITDLPQVKPGYIG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[1-amino-2-(1,3-dioxepan-2-yl)ethylidene]amino] 4-(trifluoromethyl)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[1-amino-2-(1,3-dioxepan-2-yl)ethylidene]amino] 4-(trifluoromethyl)pyridine-3-carboxylate?
The IUPAC name of [(E)-[1-amino-2-(1,3-dioxepan-2-yl)ethylidene]amino] 4-(trifluoromethyl)pyridine-3-carboxylate (CID 147786276) is [(E)-[1-amino-2-(1,3-dioxepan-2-yl)ethylidene]amino] 4-(trifluoromethyl)pyridine-3-carboxylate.
What is the SMILES notation for [(E)-[1-amino-2-(1,3-dioxepan-2-yl)ethylidene]amino] 4-(trifluoromethyl)pyridine-3-carboxylate?
The canonical SMILES for [(E)-[1-amino-2-(1,3-dioxepan-2-yl)ethylidene]amino] 4-(trifluoromethyl)pyridine-3-carboxylate is N/C(CC1OCCCCO1)=N/OC(=O)c1cnccc1C(F)(F)F.
What is the InChIKey of [(E)-[1-amino-2-(1,3-dioxepan-2-yl)ethylidene]amino] 4-(trifluoromethyl)pyridine-3-carboxylate?
The InChIKey is HITDLPQVKPGYIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F3N3O4/c15-14(16,17)10-3-4-19-8-9(10)13(21)24-20-11(18)7-12-22-5-1-2-6-23-12/h3-4,8,12H,1-2,5-7H2,(H2,18,20).
What are the key properties of [(E)-[1-amino-2-(1,3-dioxepan-2-yl)ethylidene]amino] 4-(trifluoromethyl)pyridine-3-carboxylate?
[(E)-[1-amino-2-(1,3-dioxepan-2-yl)ethylidene]amino] 4-(trifluoromethyl)pyridine-3-carboxylate has a molecular weight of 347.29 g/mol, XLogP of 2.07, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[1-amino-2-(1,3-dioxepan-2-yl)ethylidene]amino] 4-(trifluoromethyl)pyridine-3-carboxylate is sourced from PubChem (CID 147786276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).