C24H24N6O — CID 147787453
N-(1H-isoindol-5-yl)-2-(5-methoxy-1,3-dihydroisoindol-2-yl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine (PubChem CID 147787453) has the molecular formula C24H24N6O and a molecular weight of 412.50 g/mol. Its IUPAC name is N-(1H-isoindol-5-yl)-2-(5-methoxy-1,3-dihydroisoindol-2-yl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N-(1H-isoindol-5-yl)-2-(5-methoxy-1,3-dihydroisoindol-2-yl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 147787453 |
| Molecular Formula | C24H24N6O |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | N-(1H-isoindol-5-yl)-2-(5-methoxy-1,3-dihydroisoindol-2-yl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine |
| SMILES | COc1ccc2c(c1)CN(c1nc3c(c(Nc4ccc5c(c4)C=NC5)n1)CCNC3)C2 |
| InChI | InChI=1S/C24H24N6O/c1-31-20-5-3-16-13-30(14-18(16)9-20)24-28-22-12-25-7-6-21(22)23(29-24)27-19-4-2-15-10-26-11-17(15)8-19/h2-5,8-9,11,25H,6-7,10,12-14H2,1H3,(H,27,28,29) |
| InChIKey | HIYWHAMUMYUQGH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |