C28H26FN3O7 — CID 147789572
[(2E,4Z)-2-methylhexa-2,4-dienyl] (2S,4S)-2-(6-fluoro-1H-indole-3-carbonyl)-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate (PubChem CID 147789572) has the molecular formula C28H26FN3O7 and a molecular weight of 535.53 g/mol. Its IUPAC name is [(2E,4Z)-2-methylhexa-2,4-dienyl] (2S,4S)-2-(6-fluoro-1H-indole-3-carbonyl)-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate.
| Compound Name | [(2E,4Z)-2-methylhexa-2,4-dienyl] (2S,4S)-2-(6-fluoro-1H-indole-3-carbonyl)-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 147789572 |
| Molecular Formula | C28H26FN3O7 |
| Molecular Weight | 535.53 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | [(2E,4Z)-2-methylhexa-2,4-dienyl] (2S,4S)-2-(6-fluoro-1H-indole-3-carbonyl)-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate |
| SMILES | C/C=C\C=C(/C)COC(=O)N1C[C@@H](OC(=O)c2ccc([N+](=O)[O-])cc2)C[C@H]1C(=O)c1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C28H26FN3O7/c1-3-4-5-17(2)16-38-28(35)31-15-21(39-27(34)18-6-9-20(10-7-18)32(36)37)13-25(31)26(33)23-14-30-24-12-19(29)8-11-22(23)24/h3-12,14,21,25,30H,13,15-16H2,1-2H3/b4-3-,17-5+/t21-,25-/m0/s1 |
| InChIKey | HJJAVBCPEMQGNY-DHILDNHASA-N |
| XLogP | 5.36 |
| TPSA | 131.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|