C25H21F7IrNO2- — CID 147792512
1,1,1,2,2,3,3-heptafluoro-6-hydroxy-7,7-dimethyloct-5-en-4-one;iridium;1-phenylisoquinoline (PubChem CID 147792512) has the molecular formula C25H21F7IrNO2- and a molecular weight of 692.65 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-6-hydroxy-7,7-dimethyloct-5-en-4-one;iridium;1-phenylisoquinoline.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-6-hydroxy-7,7-dimethyloct-5-en-4-one;iridium;1-phenylisoquinoline |
|---|---|
| PubChem CID | 147792512 |
| Molecular Formula | C25H21F7IrNO2- |
| Molecular Weight | 692.65 g/mol |
| Exact Mass | 693.11 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-6-hydroxy-7,7-dimethyloct-5-en-4-one;iridium;1-phenylisoquinoline |
| SMILES | CC(C)(C)C(O)=CC(=O)C(F)(F)C(F)(F)C(F)(F)F.[Ir].[c-]1ccccc1-c1nccc2ccccc12 |
| InChI | InChI=1S/C15H10N.C10H11F7O2.Ir/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15;1-7(2,3)5(18)4-6(19)8(11,12)9(13,14)10(15,16)17;/h1-7,9-11H;4,18H,1-3H3;/q-1;; |
| InChIKey | ZGCMRCPEGQMPKA-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.65 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|