C8H9F3N2OS — CID 1477932
4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]morpholine (PubChem CID 1477932) has the molecular formula C8H9F3N2OS and a molecular weight of 238.23 g/mol. Its IUPAC name is 4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]morpholine.
| Compound Name | 4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]morpholine |
|---|---|
| PubChem CID | 1477932 |
| Molecular Formula | C8H9F3N2OS |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]morpholine |
| SMILES | FC(F)(F)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C8H9F3N2OS/c9-8(10,11)6-5-15-7(12-6)13-1-3-14-4-2-13/h5H,1-4H2 |
| InChIKey | UMEVSSPGBFVQNC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |