About 3-ethyl-6-propan-2-yl-1,2,4,5-tetrazine
3-ethyl-6-propan-2-yl-1,2,4,5-tetrazine (PubChem CID 147793483) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is 3-ethyl-6-propan-2-yl-1,2,4,5-tetrazine.
Molecular Properties
| Compound Name | 3-ethyl-6-propan-2-yl-1,2,4,5-tetrazine |
| PubChem CID | 147793483 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 3-ethyl-6-propan-2-yl-1,2,4,5-tetrazine |
| SMILES | CCc1nnc(C(C)C)nn1 |
| InChI | InChI=1S/C7H12N4/c1-4-6-8-10-7(5(2)3)11-9-6/h5H,4H2,1-3H3 |
| InChIKey | HKCGTEHSPMTKMV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-6-propan-2-yl-1,2,4,5-tetrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6-propan-2-yl-1,2,4,5-tetrazine?
The IUPAC name of 3-ethyl-6-propan-2-yl-1,2,4,5-tetrazine (CID 147793483) is 3-ethyl-6-propan-2-yl-1,2,4,5-tetrazine.
What is the SMILES notation for 3-ethyl-6-propan-2-yl-1,2,4,5-tetrazine?
The canonical SMILES for 3-ethyl-6-propan-2-yl-1,2,4,5-tetrazine is CCc1nnc(C(C)C)nn1.
What is the InChIKey of 3-ethyl-6-propan-2-yl-1,2,4,5-tetrazine?
The InChIKey is HKCGTEHSPMTKMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4/c1-4-6-8-10-7(5(2)3)11-9-6/h5H,4H2,1-3H3.
What are the key properties of 3-ethyl-6-propan-2-yl-1,2,4,5-tetrazine?
3-ethyl-6-propan-2-yl-1,2,4,5-tetrazine has a molecular weight of 152.20 g/mol, XLogP of 0.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6-propan-2-yl-1,2,4,5-tetrazine is sourced from PubChem (CID 147793483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).