C43H38FN7O8 — CID 147794927
4-anilino-6-[4-[4-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]butylcarbamoyl]-3-fluorophenyl]-N-methylquinoline-3-carboxamide (PubChem CID 147794927) has the molecular formula C43H38FN7O8 and a molecular weight of 799.82 g/mol. Its IUPAC name is 4-anilino-6-[4-[4-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]butylcarbamoyl]-3-fluorophenyl]-N-methylquinoline-3-carboxamide.
| Compound Name | 4-anilino-6-[4-[4-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]butylcarbamoyl]-3-fluorophenyl]-N-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 147794927 |
| Molecular Formula | C43H38FN7O8 |
| Molecular Weight | 799.82 g/mol |
| Exact Mass | 799.28 |
| IUPAC Name | 4-anilino-6-[4-[4-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]butylcarbamoyl]-3-fluorophenyl]-N-methylquinoline-3-carboxamide |
| SMILES | CNC(=O)c1cnc2ccc(-c3ccc(C(=O)NCCCCNC(=O)COc4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)c(F)c3)cc2c1Nc1ccccc1 |
| InChI | InChI=1S/C43H38FN7O8/c1-45-39(54)30-22-48-32-15-13-24(20-29(32)38(30)49-26-8-3-2-4-9-26)25-12-14-27(31(44)21-25)40(55)47-19-6-5-18-46-36(53)23-59-34-11-7-10-28-37(34)43(58)51(42(28)57)33-16-17-35(52)50-41(33)56/h2-4,7-15,20-22,33H,5-6,16-19,23H2,1H3,(H,45,54)(H,46,53)(H,47,55)(H,48,49)(H,50,52,56) |
| InChIKey | HKJFXJWJFBNDBX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 205.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.82 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|