C24H32O9 — CID 14779519
[(3S,3aR,4S,6S,6aR,7R,9aS,9bS)-3,6-diacetyloxy-7-hydroxy-3,6,9-trimethyl-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl] 3-methylbut-2-enoate (PubChem CID 14779519) has the molecular formula C24H32O9 and a molecular weight of 464.51 g/mol. Its IUPAC name is [(3S,3aR,4S,6S,6aR,7R,9aS,9bS)-3,6-diacetyloxy-7-hydroxy-3,6,9-trimethyl-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl] 3-methylbut-2-enoate.
| Compound Name | [(3S,3aR,4S,6S,6aR,7R,9aS,9bS)-3,6-diacetyloxy-7-hydroxy-3,6,9-trimethyl-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 14779519 |
| Molecular Formula | C24H32O9 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | [(3S,3aR,4S,6S,6aR,7R,9aS,9bS)-3,6-diacetyloxy-7-hydroxy-3,6,9-trimethyl-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl] 3-methylbut-2-enoate |
| SMILES | CC(=O)O[C@@]1(C)C[C@H](OC(=O)C=C(C)C)[C@@H]2[C@@H](OC(=O)[C@@]2(C)OC(C)=O)[C@@H]2C(C)=C[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C24H32O9/c1-11(2)8-17(28)30-16-10-23(6,32-13(4)25)19-15(27)9-12(3)18(19)21-20(16)24(7,22(29)31-21)33-14(5)26/h8-9,15-16,18-21,27H,10H2,1-7H3/t15-,16+,18-,19+,20-,21+,23+,24+/m1/s1 |
| InChIKey | QGEPQUSTKHRROG-AUOWRKOTSA-N |
| XLogP | 2.01 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|