About methyl (E)-oct-2-en-4,6-diynoate
methyl (E)-oct-2-en-4,6-diynoate (PubChem CID 14779621) has the molecular formula C9H8O2
and a molecular weight of 148.16 g/mol. Its IUPAC name is methyl (E)-oct-2-en-4,6-diynoate.
Molecular Properties
| Compound Name | methyl (E)-oct-2-en-4,6-diynoate |
| PubChem CID | 14779621 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | methyl (E)-oct-2-en-4,6-diynoate |
| SMILES | CC#CC#C/C=C/C(=O)OC |
| InChI | InChI=1S/C9H8O2/c1-3-4-5-6-7-8-9(10)11-2/h7-8H,1-2H3/b8-7+ |
| InChIKey | AFKZVCPNRIVQCL-BQYQJAHWSA-N |
| XLogP | 0.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-oct-2-en-4,6-diynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-oct-2-en-4,6-diynoate?
The IUPAC name of methyl (E)-oct-2-en-4,6-diynoate (CID 14779621) is methyl (E)-oct-2-en-4,6-diynoate.
What is the SMILES notation for methyl (E)-oct-2-en-4,6-diynoate?
The canonical SMILES for methyl (E)-oct-2-en-4,6-diynoate is CC#CC#C/C=C/C(=O)OC.
What is the InChIKey of methyl (E)-oct-2-en-4,6-diynoate?
The InChIKey is AFKZVCPNRIVQCL-BQYQJAHWSA-N. The full InChI is InChI=1S/C9H8O2/c1-3-4-5-6-7-8-9(10)11-2/h7-8H,1-2H3/b8-7+.
What are the key properties of methyl (E)-oct-2-en-4,6-diynoate?
methyl (E)-oct-2-en-4,6-diynoate has a molecular weight of 148.16 g/mol, XLogP of 0.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-oct-2-en-4,6-diynoate is sourced from PubChem (CID 14779621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).