About [2-[(2,5-dichlorobenzoyl)amino]acetyl]oxidanium
[2-[(2,5-dichlorobenzoyl)amino]acetyl]oxidanium (PubChem CID 147797111) has the molecular formula C9H8Cl2NO3+
and a molecular weight of 249.07 g/mol. Its IUPAC name is [2-[(2,5-dichlorobenzoyl)amino]acetyl]oxidanium.
Molecular Properties
| Compound Name | [2-[(2,5-dichlorobenzoyl)amino]acetyl]oxidanium |
| PubChem CID | 147797111 |
| Molecular Formula | C9H8Cl2NO3+ |
| Molecular Weight | 249.07 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | [2-[(2,5-dichlorobenzoyl)amino]acetyl]oxidanium |
| SMILES | O=C([OH2+])CNC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H7Cl2NO3/c10-5-1-2-7(11)6(3-5)9(15)12-4-8(13)14/h1-3H,4H2,(H,12,15)(H,13,14)/p+1 |
| InChIKey | HKUAUZSWGMQPOK-UHFFFAOYSA-O |
| XLogP | 0.97 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.07 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2,5-dichlorobenzoyl)amino]acetyl]oxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,5-dichlorobenzoyl)amino]acetyl]oxidanium?
The IUPAC name of [2-[(2,5-dichlorobenzoyl)amino]acetyl]oxidanium (CID 147797111) is [2-[(2,5-dichlorobenzoyl)amino]acetyl]oxidanium.
What is the SMILES notation for [2-[(2,5-dichlorobenzoyl)amino]acetyl]oxidanium?
The canonical SMILES for [2-[(2,5-dichlorobenzoyl)amino]acetyl]oxidanium is O=C([OH2+])CNC(=O)c1cc(Cl)ccc1Cl.
What is the InChIKey of [2-[(2,5-dichlorobenzoyl)amino]acetyl]oxidanium?
The InChIKey is HKUAUZSWGMQPOK-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H7Cl2NO3/c10-5-1-2-7(11)6(3-5)9(15)12-4-8(13)14/h1-3H,4H2,(H,12,15)(H,13,14)/p+1.
What are the key properties of [2-[(2,5-dichlorobenzoyl)amino]acetyl]oxidanium?
[2-[(2,5-dichlorobenzoyl)amino]acetyl]oxidanium has a molecular weight of 249.07 g/mol, XLogP of 0.97, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,5-dichlorobenzoyl)amino]acetyl]oxidanium is sourced from PubChem (CID 147797111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).