C23H30O2 — CID 14780070
(1R,6aS)-3,5,5-trimethyl-1-[(1R,2S)-2-phenylcyclohexyl]oxy-1,4,6,6a-tetrahydropentalen-2-one (PubChem CID 14780070) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is (1R,6aS)-3,5,5-trimethyl-1-[(1R,2S)-2-phenylcyclohexyl]oxy-1,4,6,6a-tetrahydropentalen-2-one.
| Compound Name | (1R,6aS)-3,5,5-trimethyl-1-[(1R,2S)-2-phenylcyclohexyl]oxy-1,4,6,6a-tetrahydropentalen-2-one |
|---|---|
| PubChem CID | 14780070 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | (1R,6aS)-3,5,5-trimethyl-1-[(1R,2S)-2-phenylcyclohexyl]oxy-1,4,6,6a-tetrahydropentalen-2-one |
| SMILES | CC1=C2CC(C)(C)C[C@@H]2[C@@H](O[C@@H]2CCCC[C@H]2c2ccccc2)C1=O |
| InChI | InChI=1S/C23H30O2/c1-15-18-13-23(2,3)14-19(18)22(21(15)24)25-20-12-8-7-11-17(20)16-9-5-4-6-10-16/h4-6,9-10,17,19-20,22H,7-8,11-14H2,1-3H3/t17-,19-,20+,22+/m0/s1 |
| InChIKey | NEBRGOSGFPFXLE-LLMJNHHCSA-N |
| XLogP | 5.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |