C15H10Br2N4 — CID 1478021
4,6-bis(4-bromophenyl)-1,3,5-triazin-2-amine (PubChem CID 1478021) has the molecular formula C15H10Br2N4 and a molecular weight of 406.08 g/mol. Its IUPAC name is 4,6-bis(4-bromophenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis(4-bromophenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 1478021 |
| Molecular Formula | C15H10Br2N4 |
| Molecular Weight | 406.08 g/mol |
| Exact Mass | 403.93 |
| IUPAC Name | 4,6-bis(4-bromophenyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(-c2ccc(Br)cc2)nc(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C15H10Br2N4/c16-11-5-1-9(2-6-11)13-19-14(21-15(18)20-13)10-3-7-12(17)8-4-10/h1-8H,(H2,18,19,20,21) |
| InChIKey | MKKPNXQFFQVTEG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.08 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |