C25H22BrCl2F6NO2 — CID 147802211
4-[(E)-3-(4-bromo-3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N-[(2R)-7,7,7-trifluoro-4-oxoheptan-2-yl]benzamide (PubChem CID 147802211) has the molecular formula C25H22BrCl2F6NO2 and a molecular weight of 633.25 g/mol. Its IUPAC name is 4-[(E)-3-(4-bromo-3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N-[(2R)-7,7,7-trifluoro-4-oxoheptan-2-yl]benzamide.
| Compound Name | 4-[(E)-3-(4-bromo-3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N-[(2R)-7,7,7-trifluoro-4-oxoheptan-2-yl]benzamide |
|---|---|
| PubChem CID | 147802211 |
| Molecular Formula | C25H22BrCl2F6NO2 |
| Molecular Weight | 633.25 g/mol |
| Exact Mass | 631.01 |
| IUPAC Name | 4-[(E)-3-(4-bromo-3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N-[(2R)-7,7,7-trifluoro-4-oxoheptan-2-yl]benzamide |
| SMILES | Cc1cc(/C=C/C(c2cc(Cl)c(Br)c(Cl)c2)C(F)(F)F)ccc1C(=O)N[C@H](C)CC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C25H22BrCl2F6NO2/c1-13-9-15(4-6-19(25(32,33)34)16-11-20(27)22(26)21(28)12-16)3-5-18(13)23(37)35-14(2)10-17(36)7-8-24(29,30)31/h3-6,9,11-12,14,19H,7-8,10H2,1-2H3,(H,35,37)/b6-4+/t14-,19?/m1/s1 |
| InChIKey | HLSRCSSLAFYMST-QBTJZLGESA-N |
| XLogP | 8.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.25 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|