C20H11F3N2O3S — CID 147802349
14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15,17,19-decaen-4-yl trifluoromethanesulfonate (PubChem CID 147802349) has the molecular formula C20H11F3N2O3S and a molecular weight of 416.38 g/mol. Its IUPAC name is 14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15,17,19-decaen-4-yl trifluoromethanesulfonate.
| Compound Name | 14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15,17,19-decaen-4-yl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 147802349 |
| Molecular Formula | C20H11F3N2O3S |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15,17,19-decaen-4-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c3ccccc3n3c4ccccc4nc3c2c1)C(F)(F)F |
| InChI | InChI=1S/C20H11F3N2O3S/c21-20(22,23)29(26,27)28-12-9-10-13-14-5-1-3-7-17(14)25-18-8-4-2-6-16(18)24-19(25)15(13)11-12/h1-11H |
| InChIKey | HLTJHOSKODSZHY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|