C63H113N11O13W — CID 147802787
CID 147802787 (PubChem CID 147802787) has the molecular formula C63H113N11O13W and a molecular weight of 1416.50 g/mol.
| Compound Name | CID 147802787 |
|---|---|
| PubChem CID | 147802787 |
| Molecular Formula | C63H113N11O13W |
| Molecular Weight | 1416.50 g/mol |
| Exact Mass | 1415.80 |
| IUPAC Name | — |
| SMILES | C/C=C/C[C@@H](C)[C@@H](O)[C@H]1C(=O)N[C@@H](CC)C(=O)N(C)[CH-]C(=O)N(C)[C@@H](CC(C)(C)O)C(=O)N[C@@H](C(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@@H](C(C)C)C(=O)N1C.[CH3-].[W+2] |
| InChI | InChI=1S/C62H110N11O13.CH3.W/c1-25-27-28-39(13)51(75)50-55(79)65-42(26-2)57(81)67(18)33-47(74)68(19)46(32-62(16,17)86)54(78)66-48(37(9)10)60(84)69(20)43(29-34(3)4)53(77)63-40(14)52(76)64-41(15)56(80)70(21)44(30-35(5)6)58(82)71(22)45(31-36(7)8)59(83)72(23)49(38(11)12)61(85)73(50)24;;/h25,27,33-46,48-51,75,86H,26,28-32H2,1-24H3,(H,63,77)(H,64,76)(H,65,79)(H,66,78);1H3;/q2*-1;+2/b27-25+;;/t39-,40+,41-,42+,43+,44+,45+,46+,48+,49+,50+,51-;;/m1../s1 |
| InChIKey | HLVLRVWFJDYTPD-ZNEDXLSZSA-N |
| XLogP | 2.99 |
| TPSA | 299.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 88 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1416.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|