C18H13F2N6S+ — CID 147805675
[[amino-[4-(3,5-difluoroanilino)thieno[3,2-c]quinolin-7-yl]methylidene]hydrazinylidene]azanium (PubChem CID 147805675) has the molecular formula C18H13F2N6S+ and a molecular weight of 383.41 g/mol. Its IUPAC name is [[amino-[4-(3,5-difluoroanilino)thieno[3,2-c]quinolin-7-yl]methylidene]hydrazinylidene]azanium.
| Compound Name | [[amino-[4-(3,5-difluoroanilino)thieno[3,2-c]quinolin-7-yl]methylidene]hydrazinylidene]azanium |
|---|---|
| PubChem CID | 147805675 |
| Molecular Formula | C18H13F2N6S+ |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | [[amino-[4-(3,5-difluoroanilino)thieno[3,2-c]quinolin-7-yl]methylidene]hydrazinylidene]azanium |
| SMILES | NC(=NN=[NH2+])c1ccc2c(c1)nc(Nc1cc(F)cc(F)c1)c1ccsc12 |
| InChI | InChI=1S/C18H12F2N6S/c19-10-6-11(20)8-12(7-10)23-18-14-3-4-27-16(14)13-2-1-9(5-15(13)24-18)17(21)25-26-22/h1-8H,(H,23,24)(H3,21,22,25)/p+1 |
| InChIKey | HMJPXVYNHZSQCV-UHFFFAOYSA-O |
| XLogP | 3.30 |
| TPSA | 101.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|