C25H23F2NO4 — CID 14780572
(4R,6S)-6-[(E)-2-[6-fluoro-4-(4-fluorophenyl)-1-oxido-2-propan-2-ylquinolin-1-ium-3-yl]ethenyl]-4-hydroxyoxan-2-one (PubChem CID 14780572) has the molecular formula C25H23F2NO4 and a molecular weight of 439.46 g/mol. Its IUPAC name is (4R,6S)-6-[(E)-2-[6-fluoro-4-(4-fluorophenyl)-1-oxido-2-propan-2-ylquinolin-1-ium-3-yl]ethenyl]-4-hydroxyoxan-2-one.
| Compound Name | (4R,6S)-6-[(E)-2-[6-fluoro-4-(4-fluorophenyl)-1-oxido-2-propan-2-ylquinolin-1-ium-3-yl]ethenyl]-4-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 14780572 |
| Molecular Formula | C25H23F2NO4 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | (4R,6S)-6-[(E)-2-[6-fluoro-4-(4-fluorophenyl)-1-oxido-2-propan-2-ylquinolin-1-ium-3-yl]ethenyl]-4-hydroxyoxan-2-one |
| SMILES | CC(C)c1c(/C=C/[C@@H]2C[C@@H](O)CC(=O)O2)c(-c2ccc(F)cc2)c2cc(F)ccc2[n+]1[O-] |
| InChI | InChI=1S/C25H23F2NO4/c1-14(2)25-20(9-8-19-12-18(29)13-23(30)32-19)24(15-3-5-16(26)6-4-15)21-11-17(27)7-10-22(21)28(25)31/h3-11,14,18-19,29H,12-13H2,1-2H3/b9-8+/t18-,19-/m1/s1 |
| InChIKey | FUVIHYPTVRWEBX-TYFAACHXSA-N |
| XLogP | 4.62 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|