C21H29FN2O6S — CID 147806948
1-[3-[(2R)-2-(3-cyclopentyloxy-4-fluorophenyl)propyl]sulfonylpropoxymethyl]imidazolidine-2,4-dione (PubChem CID 147806948) has the molecular formula C21H29FN2O6S and a molecular weight of 456.54 g/mol. Its IUPAC name is 1-[3-[(2R)-2-(3-cyclopentyloxy-4-fluorophenyl)propyl]sulfonylpropoxymethyl]imidazolidine-2,4-dione.
| Compound Name | 1-[3-[(2R)-2-(3-cyclopentyloxy-4-fluorophenyl)propyl]sulfonylpropoxymethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 147806948 |
| Molecular Formula | C21H29FN2O6S |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 1-[3-[(2R)-2-(3-cyclopentyloxy-4-fluorophenyl)propyl]sulfonylpropoxymethyl]imidazolidine-2,4-dione |
| SMILES | C[C@@H](CS(=O)(=O)CCCOCN1CC(=O)NC1=O)c1ccc(F)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C21H29FN2O6S/c1-15(16-7-8-18(22)19(11-16)30-17-5-2-3-6-17)13-31(27,28)10-4-9-29-14-24-12-20(25)23-21(24)26/h7-8,11,15,17H,2-6,9-10,12-14H2,1H3,(H,23,25,26)/t15-/m0/s1 |
| InChIKey | HMPSHGQJJWFHEX-HNNXBMFYSA-N |
| XLogP | 2.58 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|