C18H26N2O2S — CID 14781015
(8aR,12aS,13aS)-3-methyl-12-methylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine (PubChem CID 14781015) has the molecular formula C18H26N2O2S and a molecular weight of 334.48 g/mol. Its IUPAC name is (8aR,12aS,13aS)-3-methyl-12-methylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine.
| Compound Name | (8aR,12aS,13aS)-3-methyl-12-methylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
|---|---|
| PubChem CID | 14781015 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (8aR,12aS,13aS)-3-methyl-12-methylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
| SMILES | Cc1ccc2c(c1)CCN1C[C@H]3CCCN(S(C)(=O)=O)[C@H]3C[C@@H]21 |
| InChI | InChI=1S/C18H26N2O2S/c1-13-5-6-16-14(10-13)7-9-19-12-15-4-3-8-20(23(2,21)22)17(15)11-18(16)19/h5-6,10,15,17-18H,3-4,7-9,11-12H2,1-2H3/t15-,17+,18+/m1/s1 |
| InChIKey | AJMASVRAQXEVCD-NJAFHUGGSA-N |
| XLogP | 2.34 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |