C20H30N2O4S — CID 14781034
(8aR,12aS,13aS)-2,3-dimethoxy-6-methyl-12-methylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine (PubChem CID 14781034) has the molecular formula C20H30N2O4S and a molecular weight of 394.54 g/mol. Its IUPAC name is (8aR,12aS,13aS)-2,3-dimethoxy-6-methyl-12-methylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine.
| Compound Name | (8aR,12aS,13aS)-2,3-dimethoxy-6-methyl-12-methylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
|---|---|
| PubChem CID | 14781034 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (8aR,12aS,13aS)-2,3-dimethoxy-6-methyl-12-methylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine |
| SMILES | COc1cc2c(cc1OC)[C@@H]1C[C@H]3[C@H](CCCN3S(C)(=O)=O)CN1C(C)C2 |
| InChI | InChI=1S/C20H30N2O4S/c1-13-8-15-9-19(25-2)20(26-3)10-16(15)18-11-17-14(12-21(13)18)6-5-7-22(17)27(4,23)24/h9-10,13-14,17-18H,5-8,11-12H2,1-4H3/t13?,14-,17+,18+/m1/s1 |
| InChIKey | SQUYVGWOAPFRMA-QVAHCTSVSA-N |
| XLogP | 2.44 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |