C17H24N2O4S — CID 14781051
(4aS,7S,8aR)-7-(1,3-benzodioxol-5-yl)-6-methyl-1-methylsulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine (PubChem CID 14781051) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is (4aS,7S,8aR)-7-(1,3-benzodioxol-5-yl)-6-methyl-1-methylsulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine.
| Compound Name | (4aS,7S,8aR)-7-(1,3-benzodioxol-5-yl)-6-methyl-1-methylsulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 14781051 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (4aS,7S,8aR)-7-(1,3-benzodioxol-5-yl)-6-methyl-1-methylsulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine |
| SMILES | CN1C[C@@H]2CCCN(S(C)(=O)=O)[C@@H]2C[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H24N2O4S/c1-18-10-13-4-3-7-19(24(2,20)21)15(13)9-14(18)12-5-6-16-17(8-12)23-11-22-16/h5-6,8,13-15H,3-4,7,9-11H2,1-2H3/t13-,14-,15+/m0/s1 |
| InChIKey | RNXYZHSTXVPJLP-SOUVJXGZSA-N |
| XLogP | 1.83 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |