C18H24N2O4S — CID 14781059
(1S,16S,21S)-17-methylsulfonyl-5,7-dioxa-13,17-diazapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-2,4(8),9-triene (PubChem CID 14781059) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is (1S,16S,21S)-17-methylsulfonyl-5,7-dioxa-13,17-diazapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-2,4(8),9-triene.
| Compound Name | (1S,16S,21S)-17-methylsulfonyl-5,7-dioxa-13,17-diazapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-2,4(8),9-triene |
|---|---|
| PubChem CID | 14781059 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (1S,16S,21S)-17-methylsulfonyl-5,7-dioxa-13,17-diazapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-2,4(8),9-triene |
| SMILES | CS(=O)(=O)N1CCC[C@H]2[C@H]3c4cc5c(cc4CCN3CC[C@@H]21)OCO5 |
| InChI | InChI=1S/C18H24N2O4S/c1-25(21,22)20-6-2-3-13-15(20)5-8-19-7-4-12-9-16-17(24-11-23-16)10-14(12)18(13)19/h9-10,13,15,18H,2-8,11H2,1H3/t13-,15+,18+/m1/s1 |
| InChIKey | XBMKQYCFWOWIGM-XUWXXGDYSA-N |
| XLogP | 1.76 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |