About methyl spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-carboxylate
methyl spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-carboxylate (PubChem CID 14781072) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is methyl spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-carboxylate.
Molecular Properties
| Compound Name | methyl spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-carboxylate |
| PubChem CID | 14781072 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | methyl spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-carboxylate |
| SMILES | COC(=O)C1CC2CC1CC21OCCO1 |
| InChI | InChI=1S/C11H16O4/c1-13-10(12)9-5-8-4-7(9)6-11(8)14-2-3-15-11/h7-9H,2-6H2,1H3 |
| InChIKey | OFCWQBQITHMERU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-carboxylate?
The IUPAC name of methyl spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-carboxylate (CID 14781072) is methyl spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-carboxylate.
What is the SMILES notation for methyl spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-carboxylate?
The canonical SMILES for methyl spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-carboxylate is COC(=O)C1CC2CC1CC21OCCO1.
What is the InChIKey of methyl spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-carboxylate?
The InChIKey is OFCWQBQITHMERU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O4/c1-13-10(12)9-5-8-4-7(9)6-11(8)14-2-3-15-11/h7-9H,2-6H2,1H3.
What are the key properties of methyl spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-carboxylate?
methyl spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-carboxylate has a molecular weight of 212.24 g/mol, XLogP of 0.95, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-carboxylate is sourced from PubChem (CID 14781072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).