C19H27ClN9O7P — CID 147815652
[2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-(2H-tetrazol-5-yl)propan-2-yl]phosphonic acid (PubChem CID 147815652) has the molecular formula C19H27ClN9O7P and a molecular weight of 559.91 g/mol. Its IUPAC name is [2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-(2H-tetrazol-5-yl)propan-2-yl]phosphonic acid.
| Compound Name | [2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-(2H-tetrazol-5-yl)propan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 147815652 |
| Molecular Formula | C19H27ClN9O7P |
| Molecular Weight | 559.91 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | [2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-(2H-tetrazol-5-yl)propan-2-yl]phosphonic acid |
| SMILES | CC(Cc1nn[nH]n1)(OC[C@H]1O[C@@H](n2nnc3c(NC4CCCC4)cc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C19H27ClN9O7P/c1-19(37(32,33)34,7-13-23-26-27-24-13)35-8-11-15(30)16(31)18(36-11)29-17-14(25-28-29)10(6-12(20)22-17)21-9-4-2-3-5-9/h6,9,11,15-16,18,30-31H,2-5,7-8H2,1H3,(H,21,22)(H2,32,33,34)(H,23,24,26,27)/t11-,15-,16-,18-,19?/m1/s1 |
| InChIKey | HOFZMBSXWKYHEP-ZIAJKYJFSA-N |
| XLogP | 0.12 |
| TPSA | 226.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.91 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|