About O-[[5-[(3-fluorophenyl)methyl]-3-[3-(oxolan-3-yl)propanoyl]-1,2-oxazol-4-yl]methyl] ethanethioate
O-[[5-[(3-fluorophenyl)methyl]-3-[3-(oxolan-3-yl)propanoyl]-1,2-oxazol-4-yl]methyl] ethanethioate (PubChem CID 147817197) has the molecular formula C20H22FNO4S
and a molecular weight of 391.46 g/mol. Its IUPAC name is O-[[5-[(3-fluorophenyl)methyl]-3-[3-(oxolan-3-yl)propanoyl]-1,2-oxazol-4-yl]methyl] ethanethioate.
Molecular Properties
| Compound Name | O-[[5-[(3-fluorophenyl)methyl]-3-[3-(oxolan-3-yl)propanoyl]-1,2-oxazol-4-yl]methyl] ethanethioate |
| PubChem CID | 147817197 |
| Molecular Formula | C20H22FNO4S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | O-[[5-[(3-fluorophenyl)methyl]-3-[3-(oxolan-3-yl)propanoyl]-1,2-oxazol-4-yl]methyl] ethanethioate |
| SMILES | CC(=S)OCc1c(C(=O)CCC2CCOC2)noc1Cc1cccc(F)c1 |
| InChI | InChI=1S/C20H22FNO4S/c1-13(27)25-12-17-19(10-15-3-2-4-16(21)9-15)26-22-20(17)18(23)6-5-14-7-8-24-11-14/h2-4,9,14H,5-8,10-12H2,1H3 |
| InChIKey | HONQPCDQKXKWQR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[[5-[(3-fluorophenyl)methyl]-3-[3-(oxolan-3-yl)propanoyl]-1,2-oxazol-4-yl]methyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[[5-[(3-fluorophenyl)methyl]-3-[3-(oxolan-3-yl)propanoyl]-1,2-oxazol-4-yl]methyl] ethanethioate?
The IUPAC name of O-[[5-[(3-fluorophenyl)methyl]-3-[3-(oxolan-3-yl)propanoyl]-1,2-oxazol-4-yl]methyl] ethanethioate (CID 147817197) is O-[[5-[(3-fluorophenyl)methyl]-3-[3-(oxolan-3-yl)propanoyl]-1,2-oxazol-4-yl]methyl] ethanethioate.
What is the SMILES notation for O-[[5-[(3-fluorophenyl)methyl]-3-[3-(oxolan-3-yl)propanoyl]-1,2-oxazol-4-yl]methyl] ethanethioate?
The canonical SMILES for O-[[5-[(3-fluorophenyl)methyl]-3-[3-(oxolan-3-yl)propanoyl]-1,2-oxazol-4-yl]methyl] ethanethioate is CC(=S)OCc1c(C(=O)CCC2CCOC2)noc1Cc1cccc(F)c1.
What is the InChIKey of O-[[5-[(3-fluorophenyl)methyl]-3-[3-(oxolan-3-yl)propanoyl]-1,2-oxazol-4-yl]methyl] ethanethioate?
The InChIKey is HONQPCDQKXKWQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22FNO4S/c1-13(27)25-12-17-19(10-15-3-2-4-16(21)9-15)26-22-20(17)18(23)6-5-14-7-8-24-11-14/h2-4,9,14H,5-8,10-12H2,1H3.
What are the key properties of O-[[5-[(3-fluorophenyl)methyl]-3-[3-(oxolan-3-yl)propanoyl]-1,2-oxazol-4-yl]methyl] ethanethioate?
O-[[5-[(3-fluorophenyl)methyl]-3-[3-(oxolan-3-yl)propanoyl]-1,2-oxazol-4-yl]methyl] ethanethioate has a molecular weight of 391.46 g/mol, XLogP of 4.27, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for O-[[5-[(3-fluorophenyl)methyl]-3-[3-(oxolan-3-yl)propanoyl]-1,2-oxazol-4-yl]methyl] ethanethioate is sourced from PubChem (CID 147817197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).