C10H9F3N2O — CID 1478207
2-oxo-6-propyl-4-(trifluoromethyl)-1H-pyridine-3-carbonitrile (PubChem CID 1478207) has the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. Its IUPAC name is 2-oxo-6-propyl-4-(trifluoromethyl)-1H-pyridine-3-carbonitrile.
| Compound Name | 2-oxo-6-propyl-4-(trifluoromethyl)-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 1478207 |
| Molecular Formula | C10H9F3N2O |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-oxo-6-propyl-4-(trifluoromethyl)-1H-pyridine-3-carbonitrile |
| SMILES | CCCc1cc(C(F)(F)F)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C10H9F3N2O/c1-2-3-6-4-8(10(11,12)13)7(5-14)9(16)15-6/h4H,2-3H2,1H3,(H,15,16) |
| InChIKey | DJGJKAKZHXPMBI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |