C18H42O4Si2 — CID 14782111
(2S,5S)-1,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexane-2,5-diol (PubChem CID 14782111) has the molecular formula C18H42O4Si2 and a molecular weight of 378.70 g/mol. Its IUPAC name is (2S,5S)-1,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexane-2,5-diol.
| Compound Name | (2S,5S)-1,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexane-2,5-diol |
|---|---|
| PubChem CID | 14782111 |
| Molecular Formula | C18H42O4Si2 |
| Molecular Weight | 378.70 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | (2S,5S)-1,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexane-2,5-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O)CC[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H42O4Si2/c1-17(2,3)23(7,8)21-13-15(19)11-12-16(20)14-22-24(9,10)18(4,5)6/h15-16,19-20H,11-14H2,1-10H3/t15-,16-/m0/s1 |
| InChIKey | RWYFELQNGQNQJI-HOTGVXAUSA-N |
| XLogP | 4.53 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.70 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|