About [2-(1,4,5-triphenylimidazol-2-yl)phenyl] trifluoromethanesulfonate
[2-(1,4,5-triphenylimidazol-2-yl)phenyl] trifluoromethanesulfonate (PubChem CID 147822036) has the molecular formula C28H19F3N2O3S
and a molecular weight of 520.53 g/mol. Its IUPAC name is [2-(1,4,5-triphenylimidazol-2-yl)phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [2-(1,4,5-triphenylimidazol-2-yl)phenyl] trifluoromethanesulfonate |
| PubChem CID | 147822036 |
| Molecular Formula | C28H19F3N2O3S |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | [2-(1,4,5-triphenylimidazol-2-yl)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccccc1-c1nc(-c2ccccc2)c(-c2ccccc2)n1-c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C28H19F3N2O3S/c29-28(30,31)37(34,35)36-24-19-11-10-18-23(24)27-32-25(20-12-4-1-5-13-20)26(21-14-6-2-7-15-21)33(27)22-16-8-3-9-17-22/h1-19H |
| InChIKey | HPKOUXSLTNVVEE-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,4,5-triphenylimidazol-2-yl)phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,4,5-triphenylimidazol-2-yl)phenyl] trifluoromethanesulfonate?
The IUPAC name of [2-(1,4,5-triphenylimidazol-2-yl)phenyl] trifluoromethanesulfonate (CID 147822036) is [2-(1,4,5-triphenylimidazol-2-yl)phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [2-(1,4,5-triphenylimidazol-2-yl)phenyl] trifluoromethanesulfonate?
The canonical SMILES for [2-(1,4,5-triphenylimidazol-2-yl)phenyl] trifluoromethanesulfonate is O=S(=O)(Oc1ccccc1-c1nc(-c2ccccc2)c(-c2ccccc2)n1-c1ccccc1)C(F)(F)F.
What is the InChIKey of [2-(1,4,5-triphenylimidazol-2-yl)phenyl] trifluoromethanesulfonate?
The InChIKey is HPKOUXSLTNVVEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H19F3N2O3S/c29-28(30,31)37(34,35)36-24-19-11-10-18-23(24)27-32-25(20-12-4-1-5-13-20)26(21-14-6-2-7-15-21)33(27)22-16-8-3-9-17-22/h1-19H.
What are the key properties of [2-(1,4,5-triphenylimidazol-2-yl)phenyl] trifluoromethanesulfonate?
[2-(1,4,5-triphenylimidazol-2-yl)phenyl] trifluoromethanesulfonate has a molecular weight of 520.53 g/mol, XLogP of 7.10, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,4,5-triphenylimidazol-2-yl)phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 147822036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).