About 2-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)acetic acid
2-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)acetic acid (PubChem CID 1478229) has the molecular formula C14H10N2O3
and a molecular weight of 254.25 g/mol. Its IUPAC name is 2-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)acetic acid |
| PubChem CID | 1478229 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)acetic acid |
| SMILES | O=C(O)Cc1ccc2oc(-c3cccnc3)nc2c1 |
| InChI | InChI=1S/C14H10N2O3/c17-13(18)7-9-3-4-12-11(6-9)16-14(19-12)10-2-1-5-15-8-10/h1-6,8H,7H2,(H,17,18) |
| InChIKey | XDMCMAVRBJHYRE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)acetic acid?
The IUPAC name of 2-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)acetic acid (CID 1478229) is 2-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)acetic acid.
What is the SMILES notation for 2-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)acetic acid?
The canonical SMILES for 2-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)acetic acid is O=C(O)Cc1ccc2oc(-c3cccnc3)nc2c1.
What is the InChIKey of 2-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)acetic acid?
The InChIKey is XDMCMAVRBJHYRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O3/c17-13(18)7-9-3-4-12-11(6-9)16-14(19-12)10-2-1-5-15-8-10/h1-6,8H,7H2,(H,17,18).
What are the key properties of 2-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)acetic acid?
2-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)acetic acid has a molecular weight of 254.25 g/mol, XLogP of 2.52, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)acetic acid is sourced from PubChem (CID 1478229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).