C16H16O6 — CID 14782372
7,9,10-trihydroxy-2-methoxy-7-methyl-6,8-dihydro-5H-anthracene-1,4-dione (PubChem CID 14782372) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is 7,9,10-trihydroxy-2-methoxy-7-methyl-6,8-dihydro-5H-anthracene-1,4-dione.
| Compound Name | 7,9,10-trihydroxy-2-methoxy-7-methyl-6,8-dihydro-5H-anthracene-1,4-dione |
|---|---|
| PubChem CID | 14782372 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 7,9,10-trihydroxy-2-methoxy-7-methyl-6,8-dihydro-5H-anthracene-1,4-dione |
| SMILES | COC1=CC(=O)c2c(O)c3c(c(O)c2C1=O)CC(C)(O)CC3 |
| InChI | InChI=1S/C16H16O6/c1-16(21)4-3-7-8(6-16)14(19)12-11(13(7)18)9(17)5-10(22-2)15(12)20/h5,18-19,21H,3-4,6H2,1-2H3 |
| InChIKey | BSQLLOVCCCNOPO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|