About 3-pyrrolidin-1-ylbutanal
3-pyrrolidin-1-ylbutanal (PubChem CID 14782663) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is 3-pyrrolidin-1-ylbutanal.
Molecular Properties
| Compound Name | 3-pyrrolidin-1-ylbutanal |
| PubChem CID | 14782663 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 3-pyrrolidin-1-ylbutanal |
| SMILES | CC(CC=O)N1CCCC1 |
| InChI | InChI=1S/C8H15NO/c1-8(4-7-10)9-5-2-3-6-9/h7-8H,2-6H2,1H3 |
| InChIKey | LEMQWZFMSSUXRH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-pyrrolidin-1-ylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrolidin-1-ylbutanal?
The IUPAC name of 3-pyrrolidin-1-ylbutanal (CID 14782663) is 3-pyrrolidin-1-ylbutanal.
What is the SMILES notation for 3-pyrrolidin-1-ylbutanal?
The canonical SMILES for 3-pyrrolidin-1-ylbutanal is CC(CC=O)N1CCCC1.
What is the InChIKey of 3-pyrrolidin-1-ylbutanal?
The InChIKey is LEMQWZFMSSUXRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO/c1-8(4-7-10)9-5-2-3-6-9/h7-8H,2-6H2,1H3.
What are the key properties of 3-pyrrolidin-1-ylbutanal?
3-pyrrolidin-1-ylbutanal has a molecular weight of 141.21 g/mol, XLogP of 1.06, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrolidin-1-ylbutanal is sourced from PubChem (CID 14782663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).