About 1-(4-chlorophenyl)-3-[(3,4-dichloro-1-methylpyrazol-5-yl)-methylamino]urea
1-(4-chlorophenyl)-3-[(3,4-dichloro-1-methylpyrazol-5-yl)-methylamino]urea (PubChem CID 1478272) has the molecular formula C12H12Cl3N5O
and a molecular weight of 348.62 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(3,4-dichloro-1-methylpyrazol-5-yl)-methylamino]urea.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-3-[(3,4-dichloro-1-methylpyrazol-5-yl)-methylamino]urea |
| PubChem CID | 1478272 |
| Molecular Formula | C12H12Cl3N5O |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(3,4-dichloro-1-methylpyrazol-5-yl)-methylamino]urea |
| SMILES | CN(NC(=O)Nc1ccc(Cl)cc1)c1c(Cl)c(Cl)nn1C |
| InChI | InChI=1S/C12H12Cl3N5O/c1-19-11(9(14)10(15)17-19)20(2)18-12(21)16-8-5-3-7(13)4-6-8/h3-6H,1-2H3,(H2,16,18,21) |
| InChIKey | VTSPZHIGTSPYEH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chlorophenyl)-3-[(3,4-dichloro-1-methylpyrazol-5-yl)-methylamino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-3-[(3,4-dichloro-1-methylpyrazol-5-yl)-methylamino]urea?
The IUPAC name of 1-(4-chlorophenyl)-3-[(3,4-dichloro-1-methylpyrazol-5-yl)-methylamino]urea (CID 1478272) is 1-(4-chlorophenyl)-3-[(3,4-dichloro-1-methylpyrazol-5-yl)-methylamino]urea.
What is the SMILES notation for 1-(4-chlorophenyl)-3-[(3,4-dichloro-1-methylpyrazol-5-yl)-methylamino]urea?
The canonical SMILES for 1-(4-chlorophenyl)-3-[(3,4-dichloro-1-methylpyrazol-5-yl)-methylamino]urea is CN(NC(=O)Nc1ccc(Cl)cc1)c1c(Cl)c(Cl)nn1C.
What is the InChIKey of 1-(4-chlorophenyl)-3-[(3,4-dichloro-1-methylpyrazol-5-yl)-methylamino]urea?
The InChIKey is VTSPZHIGTSPYEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl3N5O/c1-19-11(9(14)10(15)17-19)20(2)18-12(21)16-8-5-3-7(13)4-6-8/h3-6H,1-2H3,(H2,16,18,21).
What are the key properties of 1-(4-chlorophenyl)-3-[(3,4-dichloro-1-methylpyrazol-5-yl)-methylamino]urea?
1-(4-chlorophenyl)-3-[(3,4-dichloro-1-methylpyrazol-5-yl)-methylamino]urea has a molecular weight of 348.62 g/mol, XLogP of 3.55, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-3-[(3,4-dichloro-1-methylpyrazol-5-yl)-methylamino]urea is sourced from PubChem (CID 1478272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).