C11H8N2S — CID 14782782
2-phenyl-2-(1,3-thiazol-5-yl)acetonitrile (PubChem CID 14782782) has the molecular formula C11H8N2S and a molecular weight of 200.27 g/mol. Its IUPAC name is 2-phenyl-2-(1,3-thiazol-5-yl)acetonitrile.
| Compound Name | 2-phenyl-2-(1,3-thiazol-5-yl)acetonitrile |
|---|---|
| PubChem CID | 14782782 |
| Molecular Formula | C11H8N2S |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 2-phenyl-2-(1,3-thiazol-5-yl)acetonitrile |
| SMILES | N#CC(c1ccccc1)c1cncs1 |
| InChI | InChI=1S/C11H8N2S/c12-6-10(11-7-13-8-14-11)9-4-2-1-3-5-9/h1-5,7-8,10H |
| InChIKey | QXCLFLOXGTWMMZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |